Name | 3,7,10a-trimethoxy-4,4a-dihydrooxanthren-1-one |
Wikidata | Q105127869 |
Mol. formula | C15H16O6 |
CAS registry number | - |
Mol. weight | 292.2845 |
Temporary LOTUS id | LTS0196947 |
Name | 3,7,10a-trimethoxy-4,4a-dihydrooxanthren-1-one |
Canonical SMILES | COC1=CC(=O)C2(OC)Oc3ccc(OC)cc3OC2C1 |
2D SMILES | COC1=CC(=O)C2(OC)Oc3ccc(OC)cc3OC2C1 |
IUPAC name | 3,7,10a-trimethoxy-1,4,4a,10a-tetrahydrooxanthren-1-one |
InChI | InChI=1S/C15H16O6/c1-17-9-4-5-11-12(6-9)20-14-8-10(18-2)7-13(16)15(14,19-3)21-11/h4-7,14H,8H2,1-3H3 |
InChIKey | JHCCCGDYBWNZBF-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2OC3CC=CCC13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | - | - |
Total atom number | 37 |
Heavy atom number | 21 |
Bond count | 23 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.02 |
Alogp | 1.26 |
Alogp2 | 1.59 |
Apol | 41.8807 |
Bpol | 28.0293 |
EccentricConnectivityIndexDescriptor | 349 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 1101.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 850 |
Xlogp | 0.839 |
ZagrebIndex | 114 |
TopoPSA | 63.22 |