Name | 2-methoxy-4-{3-methyl-5-[(1e)-prop-1-en-1-yl]-1-benzofuran-2-yl}phenol |
Wikidata | Q104399758 |
Mol. formula | C19H18O3 |
CAS registry number | - |
Mol. weight | 294.3451 |
Temporary LOTUS id | LTS0196816 |
Name | 2-methoxy-4-{3-methyl-5-[(1e)-prop-1-en-1-yl]-1-benzofuran-2-yl}phenol |
Canonical SMILES | C/C=C/c1ccc2oc(-c3ccc(O)c(OC)c3)c(C)c2c1 |
2D SMILES | CC=Cc1ccc2oc(-c3ccc(O)c(OC)c3)c(C)c2c1 |
IUPAC name | 2-methoxy-4-{3-methyl-5-[(1E)-prop-1-en-1-yl]-1-benzofuran-2-yl}phenol |
InChI | InChI=1S/C19H18O3/c1-4-5-13-6-9-17-15(10-13)12(2)19(22-17)14-7-8-16(20)18(11-14)21-3/h4-11,20H,1-3H3/b5-4+ |
InChIKey | HMGCTPMQYVGXSC-SNAWJCMRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1c2ccccc2cc1-c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Lignans| | | |
Total atom number | 40 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 5.1 |
Alogp2 | 26.01 |
Apol | 47.8483 |
Bpol | 23.5097 |
EccentricConnectivityIndexDescriptor | 422 |
FmfDescriptor | 0.6818 |
Fsp3 | 0.1579 |
FragmentComplexityDescriptor | 1302.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1065 |
Xlogp | 4.901 |
ZagrebIndex | 116 |
TopoPSA | 42.6 |