Name | (2e)-3-(2-hydroxyphenyl)prop-2-enal |
Wikidata | Q76303514 |
Mol. formula | C9H8O2 |
CAS registry number | - |
Mol. weight | 148.159 |
Temporary LOTUS id | LTS0196725 |
Name | (2e)-3-(2-hydroxyphenyl)prop-2-enal |
Canonical SMILES | O=C/C=C/c1ccccc1O |
2D SMILES | O=CC=Cc1ccccc1O |
IUPAC name | (2E)-3-(2-hydroxyphenyl)prop-2-enal |
InChI | InChI=1S/C9H8O2/c10-7-3-5-8-4-1-2-6-9(8)11/h1-7,11H/b5-3+ |
InChIKey | BSDNZCQPDVTDET-HWKANZROSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 19 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 9 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 1.68 |
Alogp2 | 2.83 |
Apol | 22.7783 |
Bpol | 9.7037 |
EccentricConnectivityIndexDescriptor | 118 |
FmfDescriptor | 0.5455 |
Fsp3 | 0 |
FragmentComplexityDescriptor | 251.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 166 |
Xlogp | 1.584 |
ZagrebIndex | 48 |
TopoPSA | 37.3 |