Name | (2z)-n-(4-carbamimidamidobutyl)-3-(4-hydroxyphenyl)prop-2-enimidic acid |
Wikidata | Q27158883 |
Mol. formula | C14H20N4O2 |
CAS registry number | - |
Mol. weight | 276.3347 |
Temporary LOTUS id | LTS0195507 |
Name | (2z)-n-(4-carbamimidamidobutyl)-3-(4-hydroxyphenyl)prop-2-enimidic acid |
Canonical SMILES | N=C(N)NCCCCN=C(O)/C=C\c1ccc(O)cc1 |
2D SMILES | N=C(N)NCCCCN=C(O)C=Cc1ccc(O)cc1 |
IUPAC name | (2Z)-N-(4-carbamimidamidobutyl)-3-(4-hydroxyphenyl)prop-2-enimidic acid |
InChI | InChI=1S/C14H20N4O2/c15-14(16)18-10-2-1-9-17-13(20)8-5-11-3-6-12(19)7-4-11/h3-8,19H,1-2,9-10H2,(H,17,20)(H4,15,16,18)/b8-5- |
InChIKey | AKIHYQWCLCDMMI-YVMONPNESA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Amino acids and Peptides | Phenylpropanoids (C6-C3) | Cinnamic acid amides |
Total atom number | 40 |
Heavy atom number | 20 |
Bond count | 20 |
Number of carbons | 14 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 1.23 |
Alogp2 | 1.51 |
Apol | 43.9799 |
Bpol | 23.1841 |
EccentricConnectivityIndexDescriptor | 459 |
FmfDescriptor | 0.3 |
Fsp3 | 0.2857 |
FragmentComplexityDescriptor | 1220.06 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1114 |
Xlogp | 2.034 |
ZagrebIndex | 88 |
TopoPSA | 114.72 |