Name | (3e,7e)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
Wikidata | Q27144612 |
Mol. formula | C16H26 |
CAS registry number | - |
Mol. weight | 218.3782 |
Temporary LOTUS id | LTS0194471 |
Name | (3e,7e)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
Canonical SMILES | C=C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
2D SMILES | C=CC=C(C)CCC=C(C)CCC=C(C)C |
IUPAC name | (3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
InChI | InChI=1S/C16H26/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h6,9-10,13H,1,7-8,11-12H2,2-5H3/b15-9+,16-13+ |
InChIKey | CWLVBFJCJXHUCF-RNPYNJAESA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Hydrocarbons |
Total atom number | 42 |
Heavy atom number | 16 |
Bond count | 15 |
Number of carbons | 16 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1 |
Alogp | 5.92 |
Alogp2 | 35.01 |
Apol | 45.4966 |
Bpol | 28.4234 |
EccentricConnectivityIndexDescriptor | 273 |
FmfDescriptor | 0 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1441 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 586 |
Xlogp | 6.186 |
ZagrebIndex | 64 |
TopoPSA | 0 |