Name | (3ar,4s,5ar,6r,9bs)-6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3ah,4h,5h,6h,7h,8h,9bh-naphtho[1,2-b]furan-4-yl acetate |
Wikidata | Q104995113 |
Mol. formula | C17H22O5 |
CAS registry number | - |
Mol. weight | 306.3542 |
Temporary LOTUS id | LTS0193013 |
Name | (3ar,4s,5ar,6r,9bs)-6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-3ah,4h,5h,6h,7h,8h,9bh-naphtho[1,2-b]furan-4-yl acetate |
Canonical SMILES | C=C1C(=O)O[C@@H]2C3=C(C)CC[C@@H](O)[C@]3(C)C[C@H](OC(C)=O)[C@@H]12 |
2D SMILES | C=C1C(=O)OC2C3=C(C)CCC(O)C3(C)CC(OC(C)=O)C12 |
IUPAC name | (3aR,4S,5aR,6R,9bS)-6-hydroxy-5a,9-dimethyl-3-methylidene-2-oxo-2H,3H,3aH,4H,5H,5aH,6H,7H,8H,9bH-naphtho[1,2-b]furan-4-yl acetate |
InChI | InChI=1S/C17H22O5/c1-8-5-6-12(19)17(4)7-11(21-10(3)18)13-9(2)16(20)22-15(13)14(8)17/h11-13,15,19H,2,5-7H2,1,3-4H3/t11-,12+,13+,15-,17-/m0/s1 |
InChIKey | FGWZVLFGEONBLD-KAHWEZKRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3C(=CCCC3)C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 44 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.99 |
Alogp | 1.69 |
Alogp2 | 2.84 |
Apol | 48.5994 |
Bpol | 29.7986 |
EccentricConnectivityIndexDescriptor | 294 |
FmfDescriptor | 0.5909 |
Fsp3 | 0.6471 |
FragmentComplexityDescriptor | 1654.05 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 887 |
Xlogp | 0.571 |
ZagrebIndex | 124 |
TopoPSA | 72.83 |