Name | Methyl (7r)-3-hydroxy-7-(prop-1-en-2-yl)-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
Wikidata | Q105227965 |
Mol. formula | C15H18O3 |
CAS registry number | - |
Mol. weight | 246.3022 |
Temporary LOTUS id | LTS0190825 |
Name | Methyl (7r)-3-hydroxy-7-(prop-1-en-2-yl)-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
Canonical SMILES | C=C(C)[C@@H]1CCc2cc(O)cc(C(=O)OC)c2C1 |
2D SMILES | C=C(C)C1CCc2cc(O)cc(C(=O)OC)c2C1 |
IUPAC name | methyl (7R)-3-hydroxy-7-(prop-1-en-2-yl)-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
InChI | InChI=1S/C15H18O3/c1-9(2)10-4-5-11-6-12(16)8-14(13(11)7-10)15(17)18-3/h6,8,10,16H,1,4-5,7H2,2-3H3/t10-/m1/s1 |
InChIKey | QTXBUQHQOMWGJN-SNVBAGLBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Noreudesmane sesquiterpenoids |
Total atom number | 36 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.01 |
Alogp | 3.69 |
Alogp2 | 13.65 |
Apol | 40.8083 |
Bpol | 22.5517 |
EccentricConnectivityIndexDescriptor | 233 |
FmfDescriptor | 0.5556 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 1063.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 570 |
Xlogp | 3.783 |
ZagrebIndex | 92 |
TopoPSA | 46.53 |