Name | (4s,7s,11s)-5-chloro-2,10-dioxatricyclo[5.3.1.0⁴,¹¹]undecan-4-ol |
Wikidata | Q105110641 |
Mol. formula | C9H13ClO3 |
CAS registry number | - |
Mol. weight | 204.651 |
Temporary LOTUS id | LTS0190593 |
Name | (4s,7s,11s)-5-chloro-2,10-dioxatricyclo[5.3.1.0⁴,¹¹]undecan-4-ol |
Canonical SMILES | O[C@@]12COC3OCC[C@@H](CC1Cl)[C@H]32 |
2D SMILES | OC12COC3OCCC(CC1Cl)C32 |
IUPAC name | (4S,7S,11S)-5-chloro-2,10-dioxatricyclo[5.3.1.0⁴,¹¹]undecan-4-ol |
InChI | InChI=1S/C9H13ClO3/c10-6-3-5-1-2-12-8-7(5)9(6,11)4-13-8/h5-8,11H,1-4H2/t5-,6?,7+,8?,9-/m0/s1 |
InChIKey | HYLRQTWCGVZFFU-IOXKEGPVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3COC1C32 |
Pathway | Superclass | Class |
Terpenoids | Monoterpenoids | Iridoids monoterpenoids |
Total atom number | 26 |
Heavy atom number | 13 |
Bond count | 15 |
Number of carbons | 9 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1.5 |
Alogp | 0.47 |
Alogp2 | 0.22 |
Apol | 29.0943 |
Bpol | 18.4637 |
EccentricConnectivityIndexDescriptor | 120 |
FmfDescriptor | 0.8462 |
Fsp3 | 1 |
FragmentComplexityDescriptor | 628.04 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 199 |
Xlogp | 0.515 |
ZagrebIndex | 78 |
TopoPSA | 38.69 |