Name | (3as,3br,9ar,9bs,11as)-3a-hydroxy-9a,11a-dimethyl-2h,3h,3bh,8h,9h,9bh,10h,11h-cyclopenta[a]phenanthrene-1,7-dione |
Wikidata | Q105214532 |
Mol. formula | C19H24O3 |
CAS registry number | - |
Mol. weight | 300.3928 |
Temporary LOTUS id | LTS0190217 |
Name | (3as,3br,9ar,9bs,11as)-3a-hydroxy-9a,11a-dimethyl-2h,3h,3bh,8h,9h,9bh,10h,11h-cyclopenta[a]phenanthrene-1,7-dione |
Canonical SMILES | C[C@]12CC[C@H]3[C@@H](C=CC4=CC(=O)CC[C@@]43C)[C@@]1(O)CCC2=O |
2D SMILES | CC12CCC(=O)C=C1C=CC1C2CCC2(C)C(=O)CCC12O |
IUPAC name | (3aS,3bR,9aR,9bS,11aS)-3a-hydroxy-9a,11a-dimethyl-1H,2H,3H,3aH,3bH,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthrene-1,7-dione |
InChI | InChI=1S/C19H24O3/c1-17-8-5-13(20)11-12(17)3-4-15-14(17)6-9-18(2)16(21)7-10-19(15,18)22/h3-4,11,14-15,22H,5-10H2,1-2H3/t14-,15+,17-,18+,19-/m0/s1 |
InChIKey | PTBDXTFUXPCGIP-BVRUVYRISA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2C(CCC3CCCC23)C4C1=CCCC4 |
Pathway | Superclass | Class |
Terpenoids | Steroids | Androstane steroids |
Total atom number | 46 |
Heavy atom number | 22 |
Bond count | 25 |
Number of carbons | 19 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.34 |
Alogp | 1.84 |
Alogp2 | 3.37 |
Apol | 51.849 |
Bpol | 28.153 |
EccentricConnectivityIndexDescriptor | 364 |
FmfDescriptor | 0.7727 |
Fsp3 | 0.6842 |
FragmentComplexityDescriptor | 1939.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 885 |
Xlogp | 1.367 |
ZagrebIndex | 134 |
TopoPSA | 54.37 |