Name | Methyl 12-hydroxy-12-(1-hydroxyethyl)-6-methoxy-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraene-10-carboxylate |
Wikidata | Q105246386 |
Mol. formula | C21H26N2O5 |
CAS registry number | - |
Mol. weight | 386.4423 |
Temporary LOTUS id | LTS0189861 |
Name | Methyl 12-hydroxy-12-(1-hydroxyethyl)-6-methoxy-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraene-10-carboxylate |
Canonical SMILES | COC(=O)C1=C2Nc3c(OC)cccc3C23CCN2CC(O)(C(C)O)C1CC23 |
2D SMILES | COC(=O)C1=C2Nc3c(OC)cccc3C23CCN2CC(O)(C(C)O)C1CC23 |
IUPAC name | methyl 12-hydroxy-12-(1-hydroxyethyl)-6-methoxy-8,14-diazapentacyclo[9.5.2.0¹,⁹.0²,⁷.0¹⁴,¹⁷]octadeca-2,4,6,9-tetraene-10-carboxylate |
InChI | InChI=1S/C21H26N2O5/c1-11(24)21(26)10-23-8-7-20-12-5-4-6-14(27-2)17(12)22-18(20)16(19(25)28-3)13(21)9-15(20)23/h4-6,11,13,15,22,24,26H,7-10H2,1-3H3 |
InChIKey | RVYFIZMUNICAKW-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)NC3=CC4CCN5CCC32C5C4 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Corynanthe type |
Total atom number | 54 |
Heavy atom number | 28 |
Bond count | 32 |
Number of carbons | 21 |
Minimal number of rings | 5 |
Maximal number of rings | 18 |
NP-likeness score | 1.22 |
Alogp | 0.64 |
Alogp2 | 0.41 |
Apol | 60.5066 |
Bpol | 35.8534 |
EccentricConnectivityIndexDescriptor | 473 |
FmfDescriptor | 0.6429 |
Fsp3 | 0.5714 |
FragmentComplexityDescriptor | 2608.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1618 |
Xlogp | 1.288 |
ZagrebIndex | 168 |
TopoPSA | 91.26 |