Name | [(3as,6r,6as,9ar,9bs)-9a-hydroxy-6a-methyl-3-methylidene-2,9-dioxo-hexahydro-3ah-azuleno[4,5-b]furan-6-yl]methyl 2-methylpropanoate |
Wikidata | Q105204908 |
Mol. formula | C19H26O6 |
CAS registry number | - |
Mol. weight | 350.4069 |
Temporary LOTUS id | LTS0189417 |
Name | [(3as,6r,6as,9ar,9bs)-9a-hydroxy-6a-methyl-3-methylidene-2,9-dioxo-hexahydro-3ah-azuleno[4,5-b]furan-6-yl]methyl 2-methylpropanoate |
Canonical SMILES | C=C1C(=O)O[C@H]2[C@H]1CC[C@@H](COC(=O)C(C)C)[C@]1(C)CCC(=O)[C@]21O |
2D SMILES | C=C1C(=O)OC2C1CCC(COC(=O)C(C)C)C1(C)CCC(=O)C21O |
IUPAC name | [(3aS,6R,6aS,9aR,9bS)-9a-hydroxy-6a-methyl-3-methylidene-2,9-dioxo-dodecahydroazuleno[4,5-b]furan-6-yl]methyl 2-methylpropanoate |
InChI | InChI=1S/C19H26O6/c1-10(2)16(21)24-9-12-5-6-13-11(3)17(22)25-15(13)19(23)14(20)7-8-18(12,19)4/h10,12-13,15,23H,3,5-9H2,1-2,4H3/t12-,13-,15-,18-,19-/m0/s1 |
InChIKey | PAWUSGXRJIBLEE-QBQAKCNGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCC3CCCC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Pseudoguaiane sesquiterpenoids |
Total atom number | 51 |
Heavy atom number | 25 |
Bond count | 27 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.27 |
Alogp | 2.09 |
Alogp2 | 4.38 |
Apol | 55.5886 |
Bpol | 35.1294 |
EccentricConnectivityIndexDescriptor | 437 |
FmfDescriptor | 0.52 |
Fsp3 | 0.7368 |
FragmentComplexityDescriptor | 2209.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1333 |
Xlogp | 1.318 |
ZagrebIndex | 140 |
TopoPSA | 89.9 |