Name | (3as,8ar)-3a-[(3as,8ar)-8-methyl-1h,2h,3h,8ah-pyrrolo[2,3-b]indol-3a-yl]-1,8-dimethyl-2h,3h,8ah-pyrrolo[2,3-b]indole |
Wikidata | Q105034178 |
Mol. formula | C23H28N4 |
CAS registry number | - |
Mol. weight | 360.4961 |
Temporary LOTUS id | LTS0189205 |
Name | (3as,8ar)-3a-[(3as,8ar)-8-methyl-1h,2h,3h,8ah-pyrrolo[2,3-b]indol-3a-yl]-1,8-dimethyl-2h,3h,8ah-pyrrolo[2,3-b]indole |
Canonical SMILES | CN1CC[C@@]2([C@@]34CCN[C@@H]3N(C)c3ccccc34)c3ccccc3N(C)[C@@H]12 |
2D SMILES | CN1CCC2(C34CCNC3N(C)c3ccccc34)c3ccccc3N(C)C12 |
IUPAC name | (3aS,8aR)-3a-[(3aS,8aR)-8-methyl-1H,2H,3H,3aH,8H,8aH-pyrrolo[2,3-b]indol-3a-yl]-1,8-dimethyl-1H,2H,3H,3aH,8H,8aH-pyrrolo[2,3-b]indole |
InChI | InChI=1S/C23H28N4/c1-25-15-13-23(17-9-5-7-11-19(17)27(3)21(23)25)22-12-14-24-20(22)26(2)18-10-6-4-8-16(18)22/h4-11,20-21,24H,12-15H2,1-3H3/t20-,21-,22-,23-/m1/s1 |
InChIKey | HVBLNBKSQUKBIS-SSGKUCQKSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)NC3NCCC23C45c6ccccc6NC5NCC4 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Pyrroloindole alkaloids |
Total atom number | 55 |
Heavy atom number | 27 |
Bond count | 32 |
Number of carbons | 23 |
Minimal number of rings | 6 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 3.35 |
Alogp2 | 11.25 |
Apol | 63.5502 |
Bpol | 37.2098 |
EccentricConnectivityIndexDescriptor | 435 |
FmfDescriptor | 0.8889 |
Fsp3 | 0.4783 |
FragmentComplexityDescriptor | 2898.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1393 |
Xlogp | 3.591 |
ZagrebIndex | 168 |
TopoPSA | 21.75 |