Name | 5'-(5-hydroxy-2-oxo-5h-furan-3-yl)-2,5-dimethyl-2,3,4,4a,8,8a-hexahydrospiro[naphthalene-1,3'-oxolane]-2',7-dione |
Wikidata | Q82909007 |
Mol. formula | C19H22O6 |
CAS registry number | - |
Mol. weight | 346.3751 |
Temporary LOTUS id | LTS0187890 |
Name | 5'-(5-hydroxy-2-oxo-5h-furan-3-yl)-2,5-dimethyl-2,3,4,4a,8,8a-hexahydrospiro[naphthalene-1,3'-oxolane]-2',7-dione |
Canonical SMILES | CC1=CC(=O)CC2C1CCC(C)C21CC(C2=CC(O)OC2=O)OC1=O |
2D SMILES | CC1=CC(=O)CC2C1CCC(C)C21CC(C2=CC(O)OC2=O)OC1=O |
IUPAC name | 5'-(5-hydroxy-2-oxo-2,5-dihydrofuran-3-yl)-2,5-dimethyl-3,4,4a,7,8,8a-hexahydro-2H-spiro[naphthalene-1,3'-oxolane]-2',7-dione |
InChI | InChI=1S/C19H22O6/c1-9-5-11(20)6-14-12(9)4-3-10(2)19(14)8-15(24-18(19)23)13-7-16(21)25-17(13)22/h5,7,10,12,14-16,21H,3-4,6,8H2,1-2H3 |
InChIKey | KDHLKFOOPWLPCD-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C(C1)C2OCC3(CCCC4C=CCCC43)C2 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | |Diterpenoids | |Colensane and Clerodane diterpenoids |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 19 |
Minimal number of rings | 4 |
Maximal number of rings | 5 |
NP-likeness score | 1.07 |
Alogp | 2.1 |
Alogp2 | 4.41 |
Apol | 52.9214 |
Bpol | 30.7566 |
EccentricConnectivityIndexDescriptor | 432 |
FmfDescriptor | 0.76 |
Fsp3 | 0.6316 |
FragmentComplexityDescriptor | 1900.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1316 |
Xlogp | 1.648 |
ZagrebIndex | 144 |
TopoPSA | 89.9 |