Name | (2e)-n-(2-{3-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}ethyl)-3-methanesulfonylprop-2-enimidic acid |
Wikidata | Q105349196 |
Mol. formula | C17H23NO5S |
CAS registry number | - |
Mol. weight | 353.435 |
Temporary LOTUS id | LTS0187253 |
Name | (2e)-n-(2-{3-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}ethyl)-3-methanesulfonylprop-2-enimidic acid |
Canonical SMILES | CC(C)=CCOc1ccc(CCN=C(O)/C=C/S(C)(=O)=O)cc1O |
2D SMILES | CC(C)=CCOc1ccc(CCN=C(O)C=CS(C)(=O)=O)cc1O |
IUPAC name | (2E)-N-(2-{3-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}ethyl)-3-methanesulfonylprop-2-enimidic acid |
InChI | InChI=1S/C17H23NO5S/c1-13(2)7-10-23-16-5-4-14(12-15(16)19)6-9-18-17(20)8-11-24(3,21)22/h4-5,7-8,11-12,19H,6,9-10H2,1-3H3,(H,18,20)/b11-8+ |
InChIKey | YJDWFOYXEJUGOR-DHZHZOJOSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Terpenoids | - | - |
Total atom number | 47 |
Heavy atom number | 24 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 0.79 |
Alogp | 2.39 |
Alogp2 | 5.7 |
Apol | 53.2662 |
Bpol | 34.8558 |
EccentricConnectivityIndexDescriptor | 580 |
FmfDescriptor | 0.25 |
Fsp3 | 0.3529 |
FragmentComplexityDescriptor | 1657.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1751 |
Xlogp | 2.338 |
ZagrebIndex | 112 |
TopoPSA | 104.57 |