Name | 2-[2-(2-formyl-5,5,8a-trimethyl-octahydronaphthalen-1-yl)ethylidene]butanedial |
Wikidata | Q105290142 |
Mol. formula | C20H30O3 |
CAS registry number | - |
Mol. weight | 318.4512 |
Temporary LOTUS id | LTS0186323 |
Name | 2-[2-(2-formyl-5,5,8a-trimethyl-octahydronaphthalen-1-yl)ethylidene]butanedial |
Canonical SMILES | CC1(C)CCCC2(C)C(CC=C(C=O)CC=O)C(C=O)CCC12 |
2D SMILES | CC1(C)CCCC2(C)C(CC=C(C=O)CC=O)C(C=O)CCC12 |
IUPAC name | 2-[2-(2-formyl-5,5,8a-trimethyl-decahydronaphthalen-1-yl)ethylidene]butanedial |
InChI | InChI=1S/C20H30O3/c1-19(2)10-4-11-20(3)17(7-5-15(13-22)9-12-21)16(14-23)6-8-18(19)20/h5,12-14,16-18H,4,6-11H2,1-3H3 |
InChIKey | VOEKGBXENFNRQW-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Labdane diterpenoids |
Total atom number | 53 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 3.64 |
Alogp2 | 13.25 |
Apol | 57.6098 |
Bpol | 35.6702 |
EccentricConnectivityIndexDescriptor | 380 |
FmfDescriptor | 0.4348 |
Fsp3 | 0.75 |
FragmentComplexityDescriptor | 2410.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1134 |
Xlogp | 5.888 |
ZagrebIndex | 118 |
TopoPSA | 51.21 |