Name | 5,7-dihydroxy-6,10-dimethyl-3-methylidene-3ah,4h,5h,6h,7h,8h,9h,11ah-cyclodeca[b]furan-2-one |
Wikidata | Q105011449 |
Mol. formula | C15H22O4 |
CAS registry number | - |
Mol. weight | 266.3334 |
Temporary LOTUS id | LTS0184251 |
Name | 5,7-dihydroxy-6,10-dimethyl-3-methylidene-3ah,4h,5h,6h,7h,8h,9h,11ah-cyclodeca[b]furan-2-one |
Canonical SMILES | C=C1C(=O)OC2C=C(C)CCC(O)C(C)C(O)CC12 |
2D SMILES | C=C1C(=O)OC2C=C(C)CCC(O)C(C)C(O)CC12 |
IUPAC name | 5,7-dihydroxy-6,10-dimethyl-3-methylidene-2H,3H,3aH,4H,5H,6H,7H,8H,9H,11aH-cyclodeca[b]furan-2-one |
InChI | InChI=1S/C15H22O4/c1-8-4-5-12(16)10(3)13(17)7-11-9(2)15(18)19-14(11)6-8/h6,10-14,16-17H,2,4-5,7H2,1,3H3 |
InChIKey | GLYOYLKOLBGAMF-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCCCCC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 19 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.98 |
Alogp | 1.87 |
Alogp2 | 3.5 |
Apol | 44.2774 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 253 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1422.04 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 632 |
Xlogp | 0.944 |
ZagrebIndex | 98 |
TopoPSA | 66.76 |