Name | 2-{[3-(4-hydroxy-3-methoxyphenyl)prop-1-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
Wikidata | Q104972070 |
Mol. formula | C16H22O8 |
CAS registry number | - |
Mol. weight | 342.3417 |
Temporary LOTUS id | LTS0183249 |
Name | 2-{[3-(4-hydroxy-3-methoxyphenyl)prop-1-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
Canonical SMILES | COc1cc(CC=COC2OC(CO)C(O)C(O)C2O)ccc1O |
2D SMILES | COc1cc(CC=COC2OC(CO)C(O)C(O)C2O)ccc1O |
IUPAC name | 2-{[3-(4-hydroxy-3-methoxyphenyl)prop-1-en-1-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C16H22O8/c1-22-11-7-9(4-5-10(11)18)3-2-6-23-16-15(21)14(20)13(19)12(8-17)24-16/h2,4-7,12-21H,3,8H2,1H3 |
InChIKey | CXRRKRKGZOVKBR-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 46 |
Heavy atom number | 24 |
Bond count | 25 |
Number of carbons | 16 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | -0.41 |
Alogp2 | 0.17 |
Apol | 49.2454 |
Bpol | 29.7986 |
EccentricConnectivityIndexDescriptor | 520 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1657.08 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1562 |
Xlogp | 0.28 |
ZagrebIndex | 118 |
TopoPSA | 128.84 |