Name | Aspartic acid |
Wikidata | Q27109481 |
Mol. formula | C4H7NO4 |
CAS registry number | - |
Mol. weight | 133.1029 |
Temporary LOTUS id | LTS0182847 |
Name | Aspartic acid |
Canonical SMILES | NC(CC(=O)O)C(=O)O |
2D SMILES | NC(CC(=O)O)C(=O)O |
IUPAC name | 2-aminobutanedioic acid |
InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9) |
InChIKey | CKLJMWTZIZZHCS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Amino acids and Peptides | Small peptides | Aminoacids |
Total atom number | 16 |
Heavy atom number | 9 |
Bond count | 8 |
Number of carbons | 4 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 2.34 |
Alogp | -1.25 |
Alogp2 | 1.55 |
Apol | 16.0156 |
Bpol | 8.9084 |
EccentricConnectivityIndexDescriptor | 63 |
FmfDescriptor | 0 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 153.05 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 96 |
Xlogp | -3.707 |
ZagrebIndex | 36 |
TopoPSA | 100.62 |