Name | 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]phenol |
Wikidata | Q105007145 |
Mol. formula | C18H17NO3 |
CAS registry number | - |
Mol. weight | 295.3332 |
Temporary LOTUS id | LTS0182425 |
Name | 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]phenol |
Canonical SMILES | COc1cc2ccnc(Cc3ccc(O)cc3)c2cc1OC |
2D SMILES | COc1cc2ccnc(Cc3ccc(O)cc3)c2cc1OC |
IUPAC name | 4-[(6,7-dimethoxyisoquinolin-1-yl)methyl]phenol |
InChI | InChI=1S/C18H17NO3/c1-21-17-10-13-7-8-19-16(15(13)11-18(17)22-2)9-12-3-5-14(20)6-4-12/h3-8,10-11,20H,9H2,1-2H3 |
InChIKey | GEFVYAVAFUTMCF-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | n1ccc2ccccc2c1Cc3ccccc3 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Isoquinoline alkaloids |
Total atom number | 39 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 18 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 3.27 |
Alogp2 | 10.69 |
Apol | 46.5215 |
Bpol | 23.7365 |
EccentricConnectivityIndexDescriptor | 426 |
FmfDescriptor | 0.7727 |
Fsp3 | 0.1667 |
FragmentComplexityDescriptor | 1219.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1069 |
Xlogp | 3.036 |
ZagrebIndex | 114 |
TopoPSA | 51.58 |