Name | 16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,12,14(19),15,17-heptaene |
Wikidata | Q72464873 |
Mol. formula | C20H19NO4 |
CAS registry number | - |
Mol. weight | 337.3699 |
Temporary LOTUS id | LTS0179418 |
Name | 16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,12,14(19),15,17-heptaene |
Canonical SMILES | COc1cc2cc3c4c(cc5c(c4c2cc1OC)OCO5)CCN3C |
2D SMILES | COc1cc2cc3c4c(cc5c(c4c2cc1OC)OCO5)CCN3C |
IUPAC name | 16,17-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),7,12,14(19),15,17-heptaene |
InChI | InChI=1S/C20H19NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h6-9H,4-5,10H2,1-3H3 |
InChIKey | HIZKFQOZVOUKDP-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3c4c(cc5ccccc5c4c2OC1)NCC3 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Aporphine alkaloids |
Total atom number | 44 |
Heavy atom number | 25 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 19 |
NP-likeness score | 1 |
Alogp | 3.62 |
Alogp2 | 13.1 |
Apol | 52.1771 |
Bpol | 30.4149 |
EccentricConnectivityIndexDescriptor | 426 |
FmfDescriptor | 0.8 |
Fsp3 | 0.3 |
FragmentComplexityDescriptor | 1704.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1261 |
Xlogp | 4.048 |
ZagrebIndex | 146 |
TopoPSA | 40.16 |