Name | 8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1h-picen-3-ol |
Wikidata | Q104201352 |
Mol. formula | C30H50O2 |
CAS registry number | - |
Mol. weight | 442.7179 |
Temporary LOTUS id | LTS0178123 |
Name | 8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1h-picen-3-ol |
Canonical SMILES | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
2D SMILES | CC1CCC2(CO)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1C |
IUPAC name | 8a-(hydroxymethyl)-4,4,6a,6b,11,12,14b-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicen-3-ol |
InChI | InChI=1S/C30H50O2/c1-19-10-15-30(18-31)17-16-28(6)21(25(30)20(19)2)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h8,19-20,22-25,31-32H,9-18H2,1-7H3 |
InChIKey | XUARCIYIVXVTAE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C3CCCCC3CCC2C4CCC5CCCCC5C4C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Ursane and Taraxastane triterpenoids |
Total atom number | 82 |
Heavy atom number | 32 |
Bond count | 36 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 6.26 |
Alogp2 | 39.17 |
Apol | 87.7436 |
Bpol | 54.6603 |
EccentricConnectivityIndexDescriptor | 648 |
FmfDescriptor | 0.6875 |
Fsp3 | 0.9333 |
FragmentComplexityDescriptor | 6404.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2433 |
Xlogp | 9.261 |
ZagrebIndex | 196 |
TopoPSA | 40.46 |