Name | 4,5,14-trimethoxy-9λ⁵-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,12,14-heptaen-9-ylium |
Wikidata | Q83014664 |
Mol. formula | [C18H18NO3]+ |
CAS registry number | - |
Mol. weight | 296.3411 |
Temporary LOTUS id | LTS0177138 |
Name | 4,5,14-trimethoxy-9λ⁵-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,12,14-heptaen-9-ylium |
Canonical SMILES | COc1cc2c3c(c1)c1cc(OC)c(OC)cc1c[n+]3CC2 |
2D SMILES | COc1cc2c3c(c1)c1cc(OC)c(OC)cc1c[n+]3CC2 |
IUPAC name | 4,5,14-trimethoxy-9λ⁵-azatetracyclo[7.6.1.0²,⁷.0¹²,¹⁶]hexadeca-1(16),2(7),3,5,8,12,14-heptaen-9-ylium |
InChI | InChI=1S/C18H18NO3/c1-20-13-6-11-4-5-19-10-12-7-16(21-2)17(22-3)9-14(12)15(8-13)18(11)19/h6-10H,4-5H2,1-3H3/q+1 |
InChIKey | ZHPPJUUSHATRPV-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)cn3c4c2cccc4CC3 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 40 |
Heavy atom number | 22 |
Bond count | 25 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 1.77 |
Alogp2 | 3.14 |
Apol | 47.1883 |
Bpol | 27.4057 |
EccentricConnectivityIndexDescriptor | 371 |
FmfDescriptor | 0.7273 |
Fsp3 | 0.2778 |
FragmentComplexityDescriptor | 1387.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 939 |
Xlogp | 4.185 |
ZagrebIndex | 124 |
TopoPSA | 31.57 |