Name | (2r)-1-butoxy-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl (2e)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
Wikidata | Q104888924 |
Mol. formula | C22H24O8 |
CAS registry number | - |
Mol. weight | 416.422 |
Temporary LOTUS id | LTS0176808 |
Name | (2r)-1-butoxy-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl (2e)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
Canonical SMILES | CCCCOC(=O)[C@@H](Cc1ccc(O)c(O)c1)OC(=O)/C=C/c1ccc(O)c(O)c1 |
2D SMILES | CCCCOC(=O)C(Cc1ccc(O)c(O)c1)OC(=O)C=Cc1ccc(O)c(O)c1 |
IUPAC name | (2R)-1-butoxy-3-(3,4-dihydroxyphenyl)-1-oxopropan-2-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C22H24O8/c1-2-3-10-29-22(28)20(13-15-5-8-17(24)19(26)12-15)30-21(27)9-6-14-4-7-16(23)18(25)11-14/h4-9,11-12,20,23-26H,2-3,10,13H2,1H3/b9-6+/t20-/m1/s1 |
InChIKey | QACLUURODSWXLR-AQDCRGGLSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 54 |
Heavy atom number | 30 |
Bond count | 31 |
Number of carbons | 22 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 4.27 |
Alogp2 | 18.2 |
Apol | 61.139 |
Bpol | 31.985 |
EccentricConnectivityIndexDescriptor | 724 |
FmfDescriptor | 0.6 |
Fsp3 | 0.2727 |
FragmentComplexityDescriptor | 2155.08 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2805 |
Xlogp | 4.22 |
ZagrebIndex | 144 |
TopoPSA | 133.52 |