Name | 5-hydroxy-3-isopropyl-6,6,11-trimethyltricyclo[7.4.1.0⁵,¹⁴]tetradeca-1(13),2,9(14),11-tetraen-4-one |
Wikidata | Q105270269 |
Mol. formula | C20H26O2 |
CAS registry number | - |
Mol. weight | 298.42 |
Temporary LOTUS id | LTS0173221 |
Name | 5-hydroxy-3-isopropyl-6,6,11-trimethyltricyclo[7.4.1.0⁵,¹⁴]tetradeca-1(13),2,9(14),11-tetraen-4-one |
Canonical SMILES | CC1=CC=C2C=C(C(C)C)C(=O)C3(O)C2=C(CCC3(C)C)C1 |
2D SMILES | CC1=CC=C2C=C(C(C)C)C(=O)C3(O)C2=C(CCC3(C)C)C1 |
IUPAC name | 5-hydroxy-6,6,11-trimethyl-3-(propan-2-yl)tricyclo[7.4.1.0⁵,¹⁴]tetradeca-1(13),2,9(14),11-tetraen-4-one |
InChI | InChI=1S/C20H26O2/c1-12(2)16-11-14-7-6-13(3)10-15-8-9-19(4,5)20(22,17(14)15)18(16)21/h6-7,11-12,22H,8-10H2,1-5H3 |
InChIKey | UDAMKGHKZTVCKK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C=1C=C2C=CCC3C2=C(CC1)CCC3 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Diterpenoids|Diterpenoids | Icetexane diterpenoids|Abeoabietane diterpenoids |
Total atom number | 48 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1.57 |
Alogp | 4.16 |
Alogp2 | 17.3 |
Apol | 54.1406 |
Bpol | 29.3814 |
EccentricConnectivityIndexDescriptor | 290 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.55 |
FragmentComplexityDescriptor | 2038.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 845 |
Xlogp | 3.494 |
ZagrebIndex | 126 |
TopoPSA | 37.3 |