Name | 9-(hydroxymethyl)-4-methyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradeca-7,9-dien-2-yl 2-(hydroxymethyl)but-2-enoate |
Wikidata | Q105210090 |
Mol. formula | C20H24O7 |
CAS registry number | - |
Mol. weight | 376.4011 |
Temporary LOTUS id | LTS0173037 |
Name | 9-(hydroxymethyl)-4-methyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradeca-7,9-dien-2-yl 2-(hydroxymethyl)but-2-enoate |
Canonical SMILES | C=C1C(=O)OC2C=C(CO)C=CC3OC3(C)CC(OC(=O)C(=CC)CO)C12 |
2D SMILES | C=C1C(=O)OC2C=C(CO)C=CC3OC3(C)CC(OC(=O)C(=CC)CO)C12 |
IUPAC name | 9-(hydroxymethyl)-4-methyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradeca-7,9-dien-2-yl 2-(hydroxymethyl)but-2-enoate |
InChI | InChI=1S/C20H24O7/c1-4-13(10-22)19(24)26-15-8-20(3)16(27-20)6-5-12(9-21)7-14-17(15)11(2)18(23)25-14/h4-7,14-17,21-22H,2,8-10H2,1,3H3 |
InChIKey | PJPPGFOTUNLSNL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3OC3C=CC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 51 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.97 |
Alogp | 0.87 |
Alogp2 | 0.75 |
Apol | 56.817 |
Bpol | 33.901 |
EccentricConnectivityIndexDescriptor | 473 |
FmfDescriptor | 0.5185 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 2107.07 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1673 |
Xlogp | 0.656 |
ZagrebIndex | 144 |
TopoPSA | 105.59 |