Name | (2s)-2-hydroxy-3-{[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propyl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Wikidata | Q105204407 |
Mol. formula | C18H24O10 |
CAS registry number | - |
Mol. weight | 400.3779 |
Temporary LOTUS id | LTS0172923 |
Name | (2s)-2-hydroxy-3-{[(2r,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propyl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Canonical SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@@H](O)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
2D SMILES | O=C(C=Cc1ccc(O)cc1)OCC(O)COC1OC(CO)C(O)C(O)C1O |
IUPAC name | (2S)-2-hydroxy-3-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propyl (2E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C18H24O10/c19-7-13-15(23)16(24)17(25)18(28-13)27-9-12(21)8-26-14(22)6-3-10-1-4-11(20)5-2-10/h1-6,12-13,15-21,23-25H,7-9H2/b6-3+/t12-,13-,15-,16+,17-,18-/m1/s1 |
InChIKey | PADHSFRQMFRWLS-BFQBLSCMSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3)|Phenylethanoids (C6-C2) | Cinnamic acids and derivatives|Cinnamic acids and derivatives |
Total atom number | 52 |
Heavy atom number | 28 |
Bond count | 29 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | -0.91 |
Alogp2 | 0.83 |
Apol | 55.703 |
Bpol | 32.943 |
EccentricConnectivityIndexDescriptor | 774 |
FmfDescriptor | 0.7143 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 2053.1 |
PetitjeanNumber | 0.4706 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2566 |
Xlogp | -0.665 |
ZagrebIndex | 136 |
TopoPSA | 166.14 |