Name | (6ar,7r,8s,10as)-7,8-dimethyl-7-{2-[(3r)-5-oxooxolan-3-yl]ethyl}-1h,5h,6h,6ah,8h,10h-naphtho[4,4a-c]furan-3,9-dione |
Wikidata | Q105157701 |
Mol. formula | C20H26O5 |
CAS registry number | - |
Mol. weight | 346.4182 |
Temporary LOTUS id | LTS0172280 |
Name | (6ar,7r,8s,10as)-7,8-dimethyl-7-{2-[(3r)-5-oxooxolan-3-yl]ethyl}-1h,5h,6h,6ah,8h,10h-naphtho[4,4a-c]furan-3,9-dione |
Canonical SMILES | C[C@@H]1C(=O)C[C@@]23COC(=O)C2=CCC[C@@H]3[C@@]1(C)CC[C@H]1COC(=O)C1 |
2D SMILES | CC1C(=O)CC23COC(=O)C2=CCCC3C1(C)CCC1COC(=O)C1 |
IUPAC name | (6aR,7R,8S,10aS)-7,8-dimethyl-7-{2-[(3R)-5-oxooxolan-3-yl]ethyl}-1H,3H,5H,6H,6aH,7H,8H,9H,10H-naphtho[4,4a-c]furan-3,9-dione |
InChI | InChI=1S/C20H26O5/c1-12-15(21)9-20-11-25-18(23)14(20)4-3-5-16(20)19(12,2)7-6-13-8-17(22)24-10-13/h4,12-13,16H,3,5-11H2,1-2H3/t12-,13-,16-,19+,20-/m1/s1 |
InChIKey | LUYUZBFGBTZZHC-JOXYBWGKSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC2=CCCC3C(CCCC23C1)CCC4COCC4 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Colensane and Clerodane diterpenoids |
Total atom number | 51 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.01 |
Alogp | 2.21 |
Alogp2 | 4.88 |
Apol | 56.5466 |
Bpol | 35.1294 |
EccentricConnectivityIndexDescriptor | 471 |
FmfDescriptor | 0.8 |
Fsp3 | 0.75 |
FragmentComplexityDescriptor | 2316.05 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1344 |
Xlogp | 2.293 |
ZagrebIndex | 144 |
TopoPSA | 69.67 |