Name | 5-[(1s,3ar,4r,6ar)-4-{3-methoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-hexahydrofuro[3,4-c]furan-1-yl]-2h-1,3-benzodioxole |
Wikidata | Q105321957 |
Mol. formula | C25H28O6 |
CAS registry number | - |
Mol. weight | 424.4872 |
Temporary LOTUS id | LTS0171435 |
Name | 5-[(1s,3ar,4r,6ar)-4-{3-methoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-hexahydrofuro[3,4-c]furan-1-yl]-2h-1,3-benzodioxole |
Canonical SMILES | COc1cc([C@@H]2OC[C@@H]3[C@@H](c4ccc5c(c4)OCO5)OC[C@H]23)ccc1OCC=C(C)C |
2D SMILES | COc1cc(C2OCC3C(c4ccc5c(c4)OCO5)OCC23)ccc1OCC=C(C)C |
IUPAC name | 5-[(1S,3aR,4R,6aR)-4-{3-methoxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-hexahydrofuro[3,4-c]furan-1-yl]-2H-1,3-benzodioxole |
InChI | InChI=1S/C25H28O6/c1-15(2)8-9-27-20-6-4-16(10-22(20)26-3)24-18-12-29-25(19(18)13-28-24)17-5-7-21-23(11-17)31-14-30-21/h4-8,10-11,18-19,24-25H,9,12-14H2,1-3H3/t18-,19-,24-,25+/m0/s1 |
InChIKey | WXYFFRZGPDZASV-QXVOXHNYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)C3OCC4C(OCC34)c5ccccc5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Furofuranoid lignans |
Total atom number | 59 |
Heavy atom number | 31 |
Bond count | 35 |
Number of carbons | 25 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.9 |
Alogp2 | 15.22 |
Apol | 67.4822 |
Bpol | 42.1058 |
EccentricConnectivityIndexDescriptor | 893 |
FmfDescriptor | 0.7419 |
Fsp3 | 0.44 |
FragmentComplexityDescriptor | 3039.06 |
PetitjeanNumber | 0.4706 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2968 |
Xlogp | 4.02 |
ZagrebIndex | 170 |
TopoPSA | 55.38 |