Name | (3ar,6as,7r,10as,10br)-3a-hydroxy-2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-6ah,7h,8h,9h,10ah,10bh-cyclohexa[e]azulene-1,4-dione |
Wikidata | Q105010946 |
Mol. formula | C20H24O3 |
CAS registry number | - |
Mol. weight | 312.4035 |
Temporary LOTUS id | LTS0170097 |
Name | (3ar,6as,7r,10as,10br)-3a-hydroxy-2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-6ah,7h,8h,9h,10ah,10bh-cyclohexa[e]azulene-1,4-dione |
Canonical SMILES | C=C1CC[C@@H](C(=C)C)[C@@H]2C=C(C)C(=O)[C@@]3(O)C=C(C)C(=O)[C@@H]3[C@@H]12 |
2D SMILES | C=C(C)C1CCC(=C)C2C1C=C(C)C(=O)C1(O)C=C(C)C(=O)C21 |
IUPAC name | (3aR,6aS,7R,10aS,10bR)-3a-hydroxy-2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-1H,3aH,4H,6aH,7H,8H,9H,10H,10aH,10bH-cyclohexa[e]azulene-1,4-dione |
InChI | InChI=1S/C20H24O3/c1-10(2)14-7-6-11(3)16-15(14)8-12(4)19(22)20(23)9-13(5)18(21)17(16)20/h8-9,14-17,23H,1,3,6-7H2,2,4-5H3/t14-,15-,16-,17-,20+/m0/s1 |
InChIKey | GLIADXUPICDEPH-DRCYAFTPSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCCC2C3CC=CC3C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Rhamnofolane diterpenoids |
Total atom number | 47 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.42 |
Alogp | 3.19 |
Alogp2 | 10.16 |
Apol | 53.609 |
Bpol | 28.153 |
EccentricConnectivityIndexDescriptor | 301 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1895.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 955 |
Xlogp | 2.591 |
ZagrebIndex | 130 |
TopoPSA | 54.37 |