Name | 2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-2h,3h,6ah,7h,8h,9h,10ah-cyclohexa[e]azulene-1,4-dione |
Wikidata | Q105361355 |
Mol. formula | C20H24O2 |
CAS registry number | - |
Mol. weight | 296.4041 |
Temporary LOTUS id | LTS0169229 |
Name | 2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-2h,3h,6ah,7h,8h,9h,10ah-cyclohexa[e]azulene-1,4-dione |
Canonical SMILES | C=C(C)C1CCC(=C)C2C3=C(CC(C)C3=O)C(=O)C(C)=CC12 |
2D SMILES | C=C(C)C1CCC(=C)C2C3=C(CC(C)C3=O)C(=O)C(C)=CC12 |
IUPAC name | 2,5-dimethyl-10-methylidene-7-(prop-1-en-2-yl)-1H,2H,3H,4H,6aH,7H,8H,9H,10H,10aH-cyclohexa[e]azulene-1,4-dione |
InChI | InChI=1S/C20H24O2/c1-10(2)14-7-6-11(3)17-15(14)8-12(4)19(21)16-9-13(5)20(22)18(16)17/h8,13-15,17H,1,3,6-7,9H2,2,4-5H3 |
InChIKey | YTEYTHRWXHJPKG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCCC2C3=C(C1)CCC3 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Rhamnofolane diterpenoids |
Total atom number | 46 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.06 |
Alogp | 4.19 |
Alogp2 | 17.58 |
Apol | 52.807 |
Bpol | 28.153 |
EccentricConnectivityIndexDescriptor | 288 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1842.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 868 |
Xlogp | 2.896 |
ZagrebIndex | 122 |
TopoPSA | 34.14 |