Name | (1s,2r,4ar,8ar)-1,4a,5-trimethyl-1-(3-methylidenepent-4-en-1-yl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
Wikidata | Q105111311 |
Mol. formula | C20H30O2 |
CAS registry number | - |
Mol. weight | 302.4518 |
Temporary LOTUS id | LTS0168365 |
Name | (1s,2r,4ar,8ar)-1,4a,5-trimethyl-1-(3-methylidenepent-4-en-1-yl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
Canonical SMILES | C=CC(=C)CC[C@]1(C)[C@H](C(=O)O)CC[C@@]2(C)C(C)=CCC[C@H]12 |
2D SMILES | C=CC(=C)CCC1(C)C(C(=O)O)CCC2(C)C(C)=CCCC21 |
IUPAC name | (1S,2R,4aR,8aR)-1,4a,5-trimethyl-1-(3-methylidenepent-4-en-1-yl)-1,2,3,4,4a,7,8,8a-octahydronaphthalene-2-carboxylic acid |
InChI | InChI=1S/C20H30O2/c1-6-14(2)10-12-20(5)16(18(21)22)11-13-19(4)15(3)8-7-9-17(19)20/h6,8,16-17H,1-2,7,9-13H2,3-5H3,(H,21,22)/t16-,17-,19-,20+/m0/s1 |
InChIKey | IDFBKACEWOZHRY-QGZVKYPTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCCC2CC1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Colensane and Clerodane diterpenoids |
Total atom number | 52 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.27 |
Alogp | 5.1 |
Alogp2 | 25.98 |
Apol | 56.8078 |
Bpol | 33.7542 |
EccentricConnectivityIndexDescriptor | 322 |
FmfDescriptor | 0.4545 |
Fsp3 | 0.65 |
FragmentComplexityDescriptor | 2347.02 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 944 |
Xlogp | 6.618 |
ZagrebIndex | 116 |
TopoPSA | 37.3 |