Name | 1-{2-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-3-phenylprop-2-en-1-one |
Wikidata | Q104166399 |
Mol. formula | C20H20O3 |
CAS registry number | - |
Mol. weight | 308.3717 |
Temporary LOTUS id | LTS0167088 |
Name | 1-{2-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-3-phenylprop-2-en-1-one |
Canonical SMILES | CC(C)=CCOc1ccc(C(=O)C=Cc2ccccc2)c(O)c1 |
2D SMILES | CC(C)=CCOc1ccc(C(=O)C=Cc2ccccc2)c(O)c1 |
IUPAC name | 1-{2-hydroxy-4-[(3-methylbut-2-en-1-yl)oxy]phenyl}-3-phenylprop-2-en-1-one |
InChI | InChI=1S/C20H20O3/c1-15(2)12-13-23-17-9-10-18(20(22)14-17)19(21)11-8-16-6-4-3-5-7-16/h3-12,14,22H,13H2,1-2H3 |
InChIKey | DGUGLZYULGVSIZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 43 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 4.88 |
Alogp2 | 23.85 |
Apol | 50.9419 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 536 |
FmfDescriptor | 0.6522 |
Fsp3 | 0.15 |
FragmentComplexityDescriptor | 1430.03 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1442 |
Xlogp | 4.987 |
ZagrebIndex | 110 |
TopoPSA | 46.53 |