Name | (1s,2r)-8-isopropyl-1,3-dimethyltricyclo[4.4.0.0²,⁷]dec-3-ene |
Wikidata | Q104253173 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0167051 |
Name | (1s,2r)-8-isopropyl-1,3-dimethyltricyclo[4.4.0.0²,⁷]dec-3-ene |
Canonical SMILES | CC1=CCC2C3C(C(C)C)CC[C@]2(C)[C@@H]13 |
2D SMILES | CC1=CCC2C3C(C(C)C)CCC2(C)C13 |
IUPAC name | (1S,2R)-1,3-dimethyl-8-(propan-2-yl)tricyclo[4.4.0.0²,⁷]dec-3-ene |
InChI | InChI=1S/C15H24/c1-9(2)11-7-8-15(4)12-6-5-10(3)14(15)13(11)12/h5,9,11-14H,6-8H2,1-4H3/t11?,12?,13?,14-,15-/m0/s1 |
InChIKey | VLXDPFLIRFYIME-JDKRLRMNSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2C3CCCC2C3C1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Copaane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 4.17 |
Alogp2 | 17.38 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 159 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 314 |
Xlogp | 6.499 |
ZagrebIndex | 90 |
TopoPSA | 0 |