Name | 5-{5-[(acetyloxy)methyl]-5,8a-dimethyl-2-methylidene-hexahydro-1h-naphthalen-1-yl}-3-methylpent-2-enoic acid |
Wikidata | Q105275397 |
Mol. formula | C22H34O4 |
CAS registry number | - |
Mol. weight | 362.5038 |
Temporary LOTUS id | LTS0163530 |
Name | 5-{5-[(acetyloxy)methyl]-5,8a-dimethyl-2-methylidene-hexahydro-1h-naphthalen-1-yl}-3-methylpent-2-enoic acid |
Canonical SMILES | C=C1CCC2C(C)(COC(C)=O)CCCC2(C)C1CCC(C)=CC(=O)O |
2D SMILES | C=C1CCC2C(C)(COC(C)=O)CCCC2(C)C1CCC(C)=CC(=O)O |
IUPAC name | 5-{5-[(acetyloxy)methyl]-5,8a-dimethyl-2-methylidene-decahydronaphthalen-1-yl}-3-methylpent-2-enoic acid |
InChI | InChI=1S/C22H34O4/c1-15(13-20(24)25)7-9-18-16(2)8-10-19-21(4,14-26-17(3)23)11-6-12-22(18,19)5/h13,18-19H,2,6-12,14H2,1,3-5H3,(H,24,25) |
InChIKey | ULWOIBVJYLRVQJ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2CCCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Labdane diterpenoids |
Total atom number | 60 |
Heavy atom number | 26 |
Bond count | 27 |
Number of carbons | 22 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.24 |
Alogp | 4.99 |
Alogp2 | 24.87 |
Apol | 64.599 |
Bpol | 41.001 |
EccentricConnectivityIndexDescriptor | 511 |
FmfDescriptor | 0.3846 |
Fsp3 | 0.7273 |
FragmentComplexityDescriptor | 3071.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1659 |
Xlogp | 5.949 |
ZagrebIndex | 134 |
TopoPSA | 63.6 |