Name | 8,19-dihydroxy-7-(hydroxymethyl)-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-en-5-one |
Wikidata | Q105143914 |
Mol. formula | C30H48O4 |
CAS registry number | - |
Mol. weight | 472.7009 |
Temporary LOTUS id | LTS0163070 |
Name | 8,19-dihydroxy-7-(hydroxymethyl)-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-en-5-one |
Canonical SMILES | CC12CCC3C(C)(C)C(O)CCC3(C)C1CCC1C(=CC(=O)C3C(C)(CO)C(O)CCC13C)C2 |
2D SMILES | CC12CCC3C(C)(C)C(O)CCC3(C)C1CCC1C(=CC(=O)C3C(C)(CO)C(O)CCC13C)C2 |
IUPAC name | 8,19-dihydroxy-7-(hydroxymethyl)-1,7,11,16,20,20-hexamethylpentacyclo[13.8.0.0³,¹².0⁶,¹¹.0¹⁶,²¹]tricos-3-en-5-one |
InChI | InChI=1S/C30H48O4/c1-26(2)21-9-12-27(3)16-18-15-20(32)25-28(4,13-11-24(34)30(25,6)17-31)19(18)7-8-22(27)29(21,5)14-10-23(26)33/h15,19,21-25,31,33-34H,7-14,16-17H2,1-6H3 |
InChIKey | KOODQVYYUVVRJN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CC3CCC4CCCCC4C3CCC2C5CCCCC5C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Serratane triterpenoids |
Total atom number | 82 |
Heavy atom number | 34 |
Bond count | 38 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1.01 |
Alogp | 4.43 |
Alogp2 | 19.63 |
Apol | 88.0141 |
Bpol | 53.4319 |
EccentricConnectivityIndexDescriptor | 747 |
FmfDescriptor | 0.6765 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 6274.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2931 |
Xlogp | 6.612 |
ZagrebIndex | 206 |
TopoPSA | 77.76 |