Name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
Wikidata | Q83033707 |
Mol. formula | C24H30O8 |
CAS registry number | - |
Mol. weight | 446.4911 |
Temporary LOTUS id | LTS0161042 |
Name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
Canonical SMILES | CCCC(=O)c1c(O)cc(OC)c(Cc2c(O)c(C(=O)CCC)c(O)c(C)c2OC)c1O |
2D SMILES | CCCC(=O)c1c(O)cc(OC)c(Cc2c(O)c(C(=O)CCC)c(O)c(C)c2OC)c1O |
IUPAC name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxy-5-methylphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
InChI | InChI=1S/C24H30O8/c1-6-8-15(25)19-17(27)11-18(31-4)13(22(19)29)10-14-23(30)20(16(26)9-7-2)21(28)12(3)24(14)32-5/h11,27-30H,6-10H2,1-5H3 |
InChIKey | ABJZJBCLEZJOTC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)Cc2ccccc2 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Dimeric phloroglucinols |
Total atom number | 62 |
Heavy atom number | 32 |
Bond count | 33 |
Number of carbons | 24 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.03 |
Alogp | 4.91 |
Alogp2 | 24.15 |
Apol | 68.6598 |
Bpol | 38.5442 |
EccentricConnectivityIndexDescriptor | 681 |
FmfDescriptor | 0.4063 |
Fsp3 | 0.4167 |
FragmentComplexityDescriptor | 2977.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2734 |
Xlogp | 5.323 |
ZagrebIndex | 160 |
TopoPSA | 133.52 |