Name | 3-{4-[(3,7-dimethylocta-2,6-dien-1-yl)oxy]-3,5-dimethoxyphenyl}prop-2-en-1-ol |
Wikidata | Q105173669 |
Mol. formula | C21H30O4 |
CAS registry number | - |
Mol. weight | 346.4613 |
Temporary LOTUS id | LTS0160494 |
Name | 3-{4-[(3,7-dimethylocta-2,6-dien-1-yl)oxy]-3,5-dimethoxyphenyl}prop-2-en-1-ol |
Canonical SMILES | COc1cc(C=CCO)cc(OC)c1OCC=C(C)CCC=C(C)C |
2D SMILES | COc1cc(C=CCO)cc(OC)c1OCC=C(C)CCC=C(C)C |
IUPAC name | 3-{4-[(3,7-dimethylocta-2,6-dien-1-yl)oxy]-3,5-dimethoxyphenyl}prop-2-en-1-ol |
InChI | InChI=1S/C21H30O4/c1-16(2)8-6-9-17(3)11-13-25-21-19(23-4)14-18(10-7-12-22)15-20(21)24-5/h7-8,10-11,14-15,22H,6,9,12-13H2,1-5H3 |
InChIKey | MWNIFFJAKKQUJF-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Terpenoids | | | | |
Total atom number | 55 |
Heavy atom number | 25 |
Bond count | 25 |
Number of carbons | 21 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 4.94 |
Alogp2 | 24.37 |
Apol | 60.1718 |
Bpol | 38.5442 |
EccentricConnectivityIndexDescriptor | 589 |
FmfDescriptor | 0.24 |
Fsp3 | 0.4286 |
FragmentComplexityDescriptor | 2425.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1794 |
Xlogp | 4.313 |
ZagrebIndex | 112 |
TopoPSA | 47.92 |