Name | 4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-1,3-diol |
Wikidata | Q105291071 |
Mol. formula | C30H50O2 |
CAS registry number | - |
Mol. weight | 442.7179 |
Temporary LOTUS id | LTS0160123 |
Name | 4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-1,3-diol |
Canonical SMILES | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)C(O)CC(O)C(C)(C)C5CCC43C)C2C1 |
2D SMILES | CC1(C)CCC2(C)CCC3(C)C(=CCC4C5(C)C(O)CC(O)C(C)(C)C5CCC43C)C2C1 |
IUPAC name | 4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,14,14a,14b-icosahydropicene-1,3-diol |
InChI | InChI=1S/C30H50O2/c1-25(2)13-14-27(5)15-16-28(6)19(20(27)18-25)9-10-22-29(28,7)12-11-21-26(3,4)23(31)17-24(32)30(21,22)8/h9,20-24,31-32H,10-18H2,1-8H3 |
InChIKey | VPWXGMNKWRCBHL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C3CCCCC3CCC2C4CCC5CCCCC5C4C1 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Oleanane triterpenoids |
Total atom number | 82 |
Heavy atom number | 32 |
Bond count | 36 |
Number of carbons | 30 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 6.08 |
Alogp2 | 36.94 |
Apol | 87.7436 |
Bpol | 54.6603 |
EccentricConnectivityIndexDescriptor | 646 |
FmfDescriptor | 0.6875 |
Fsp3 | 0.9333 |
FragmentComplexityDescriptor | 6404.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2426 |
Xlogp | 9.883 |
ZagrebIndex | 200 |
TopoPSA | 40.46 |