Name | Selenocystathionine |
Wikidata | Q27103094 |
Mol. formula | C7H14N2O4Se |
CAS registry number | - |
Mol. weight | 269.1567 |
Temporary LOTUS id | LTS0158340 |
Name | Selenocystathionine |
Canonical SMILES | NC(CC[Se]CC(N)C(=O)O)C(=O)O |
2D SMILES | NC(CC[Se]CC(N)C(=O)O)C(=O)O |
IUPAC name | 2-amino-4-[(2-amino-2-carboxyethyl)selanyl]butanoic acid |
InChI | InChI=1S/C7H14N2O4Se/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13) |
InChIKey | ZNWYDQPOUQRDLY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Amino acids and Peptides | Small peptides | Aminoacids |
Total atom number | 28 |
Heavy atom number | 14 |
Bond count | 13 |
Number of carbons | 7 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.86 |
Alogp | -1.99 |
Alogp2 | 3.98 |
Apol | 30.8331 |
Bpol | 19.9209 |
EccentricConnectivityIndexDescriptor | 186 |
FmfDescriptor | 0 |
Fsp3 | 0.7143 |
FragmentComplexityDescriptor | 547.07 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 379 |
Xlogp | -3.464 |
ZagrebIndex | 58 |
TopoPSA | 126.64 |