Name | Ethyl 2-furoate |
Wikidata | Q27288446 |
Mol. formula | C7H8O3 |
CAS registry number | - |
Mol. weight | 140.1369 |
Temporary LOTUS id | LTS0157652 |
Name | Ethyl 2-furoate |
Canonical SMILES | CCOC(=O)c1ccco1 |
2D SMILES | CCOC(=O)c1ccco1 |
IUPAC name | ethyl furan-2-carboxylate |
InChI | InChI=1S/C7H8O3/c1-2-9-7(8)6-4-3-5-10-6/h3-5H,2H2,1H3 |
InChIKey | NHXSTXWKZVAVOQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1cccc1 |
Pathway | Superclass | Class |
Fatty acids | Fatty esters | Wax monoesters |
Total atom number | 18 |
Heavy atom number | 10 |
Bond count | 10 |
Number of carbons | 7 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.02 |
Alogp | 1.43 |
Alogp2 | 2.04 |
Apol | 20.0603 |
Bpol | 13.5357 |
EccentricConnectivityIndexDescriptor | 93 |
FmfDescriptor | 0.5 |
Fsp3 | 0.2857 |
FragmentComplexityDescriptor | 234.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 125 |
Xlogp | 1.081 |
ZagrebIndex | 44 |
TopoPSA | 39.44 |