Name | 4-(acetyloxy)-7,7a-dimethyl-4'-methylidene-2'-oxo-hexahydro-1h-spiro[indene-2,3'-oxolan]-3-yl 3-methylbutanoate |
Wikidata | Q105299863 |
Mol. formula | C22H32O6 |
CAS registry number | - |
Mol. weight | 392.4867 |
Temporary LOTUS id | LTS0156723 |
Name | 4-(acetyloxy)-7,7a-dimethyl-4'-methylidene-2'-oxo-hexahydro-1h-spiro[indene-2,3'-oxolan]-3-yl 3-methylbutanoate |
Canonical SMILES | C=C1COC(=O)C12CC1(C)C(C)CCC(OC(C)=O)C1C2OC(=O)CC(C)C |
2D SMILES | C=C1COC(=O)C12CC1(C)C(C)CCC(OC(C)=O)C1C2OC(=O)CC(C)C |
IUPAC name | 7-(acetyloxy)-3a,4-dimethyl-4'-methylidene-2'-oxo-octahydrospiro[indene-2,3'-oxolan]-1-yl 3-methylbutanoate |
InChI | InChI=1S/C22H32O6/c1-12(2)9-17(24)28-19-18-16(27-15(5)23)8-7-13(3)21(18,6)11-22(19)14(4)10-26-20(22)25/h12-13,16,18-19H,4,7-11H2,1-3,5-6H3 |
InChIKey | VZNFGMWFDBTXKT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2(C1)CC3CCCCC3C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Fukinane sesquiterpenoids |
Total atom number | 60 |
Heavy atom number | 28 |
Bond count | 30 |
Number of carbons | 22 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.07 |
Alogp | 3.26 |
Alogp2 | 10.61 |
Apol | 64.8694 |
Bpol | 43.6046 |
EccentricConnectivityIndexDescriptor | 452 |
FmfDescriptor | 0.4643 |
Fsp3 | 0.7727 |
FragmentComplexityDescriptor | 3088.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1741 |
Xlogp | 4.333 |
ZagrebIndex | 154 |
TopoPSA | 78.9 |