Name | (2r)-8,8-dimethyl-2-phenyl-2h,3h-pyrano[2,3-f]chromen-4-one |
Wikidata | Q105009536 |
Mol. formula | C20H18O3 |
CAS registry number | - |
Mol. weight | 306.3559 |
Temporary LOTUS id | LTS0156066 |
Name | (2r)-8,8-dimethyl-2-phenyl-2h,3h-pyrano[2,3-f]chromen-4-one |
Canonical SMILES | CC1(C)C=Cc2c(ccc3c2O[C@@H](c2ccccc2)CC3=O)O1 |
2D SMILES | CC1(C)C=Cc2c(ccc3c2OC(c2ccccc2)CC3=O)O1 |
IUPAC name | (2R)-8,8-dimethyl-2-phenyl-2H,3H,4H,8H-pyrano[2,3-f]chromen-4-one |
InChI | InChI=1S/C20H18O3/c1-20(2)11-10-15-17(23-20)9-8-14-16(21)12-18(22-19(14)15)13-6-4-3-5-7-13/h3-11,18H,12H2,1-2H3/t18-/m1/s1 |
InChIKey | GJRSGESHUAFWMY-GOSISDBHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3c(OC(c4ccccc4)CC3)c2C=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavanones |
Total atom number | 41 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.02 |
Alogp | 3.89 |
Alogp2 | 15.11 |
Apol | 49.6083 |
Bpol | 24.4677 |
EccentricConnectivityIndexDescriptor | 432 |
FmfDescriptor | 0.8696 |
Fsp3 | 0.25 |
FragmentComplexityDescriptor | 1430.03 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1124 |
Xlogp | 4.088 |
ZagrebIndex | 130 |
TopoPSA | 35.53 |