Name | (2r,3r,3ar,4s,7s,7ar)-4-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxo-hexahydro-1h-spiro[indene-2,3'-oxolan]-3-yl (2z)-2-methylbut-2-enoate |
Wikidata | Q105024198 |
Mol. formula | C20H28O5 |
CAS registry number | - |
Mol. weight | 348.4341 |
Temporary LOTUS id | LTS0153202 |
Name | (2r,3r,3ar,4s,7s,7ar)-4-hydroxy-7,7a-dimethyl-4'-methylidene-2'-oxo-hexahydro-1h-spiro[indene-2,3'-oxolan]-3-yl (2z)-2-methylbut-2-enoate |
Canonical SMILES | C=C1COC(=O)[C@]12C[C@]1(C)[C@@H](C)CC[C@H](O)[C@@H]1[C@H]2OC(=O)/C(C)=C\C |
2D SMILES | C=C1COC(=O)C12CC1(C)C(C)CCC(O)C1C2OC(=O)C(C)=CC |
IUPAC name | (1R,2R,3aR,4S,7S,7aR)-7-hydroxy-3a,4-dimethyl-4'-methylidene-2'-oxo-octahydrospiro[indene-2,3'-oxolan]-1-yl (2Z)-2-methylbut-2-enoate |
InChI | InChI=1S/C20H28O5/c1-6-11(2)17(22)25-16-15-14(21)8-7-12(3)19(15,5)10-20(16)13(4)9-24-18(20)23/h6,12,14-16,21H,4,7-10H2,1-3,5H3/b11-6-/t12-,14-,15+,16+,19+,20+/m0/s1 |
InChIKey | GYVDIKRRVZJBTL-HKTLJSNGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2(C1)CC3CCCCC3C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Fukinane sesquiterpenoids |
Total atom number | 53 |
Heavy atom number | 25 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.05 |
Alogp | 3.05 |
Alogp2 | 9.3 |
Apol | 57.8802 |
Bpol | 36.3578 |
EccentricConnectivityIndexDescriptor | 382 |
FmfDescriptor | 0.52 |
Fsp3 | 0.7 |
FragmentComplexityDescriptor | 2425.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1253 |
Xlogp | 3.26 |
ZagrebIndex | 140 |
TopoPSA | 72.83 |