Name | (1s,2r,9r,10r)-7,15-diazatetracyclo[7.7.1.0²,⁷.0¹⁰,¹⁵]heptadec-5-en-8-one |
Wikidata | Q105200448 |
Mol. formula | C15H22N2O |
CAS registry number | - |
Mol. weight | 246.3485 |
Temporary LOTUS id | LTS0152823 |
Name | (1s,2r,9r,10r)-7,15-diazatetracyclo[7.7.1.0²,⁷.0¹⁰,¹⁵]heptadec-5-en-8-one |
Canonical SMILES | O=C1[C@@H]2C[C@@H](CN3CCCC[C@H]23)[C@H]2CCC=CN12 |
2D SMILES | O=C1C2CC(CN3CCCCC23)C2CCC=CN12 |
IUPAC name | (1S,2R,9R,10R)-7,15-diazatetracyclo[7.7.1.0²,⁷.0¹⁰,¹⁵]heptadec-5-en-8-one |
InChI | InChI=1S/C15H22N2O/c18-15-12-9-11(13-5-2-4-8-17(13)15)10-16-7-3-1-6-14(12)16/h4,8,11-14H,1-3,5-7,9-10H2/t11-,12+,13+,14+/m0/s1 |
InChIKey | OUUSQTVRZSKTBG-REWJHTLYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC2N1CC3CC2CN4CCCCC43 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Quinolizidine alkaloids |
Total atom number | 40 |
Heavy atom number | 18 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 0.91 |
Alogp | 1.3 |
Alogp2 | 1.7 |
Apol | 44.0714 |
Bpol | 28.9686 |
EccentricConnectivityIndexDescriptor | 263 |
FmfDescriptor | 0.9444 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1543.03 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 521 |
Xlogp | 1.257 |
ZagrebIndex | 104 |
TopoPSA | 23.55 |