Name | 1,3,6,7-tetramethoxyxanthen-9-one |
Wikidata | Q82073940 |
Mol. formula | C17H16O6 |
CAS registry number | - |
Mol. weight | 316.306 |
Temporary LOTUS id | LTS0152674 |
Name | 1,3,6,7-tetramethoxyxanthen-9-one |
Canonical SMILES | COc1cc(OC)c2c(=O)c3cc(OC)c(OC)cc3oc2c1 |
2D SMILES | COc1cc(OC)c2c(=O)c3cc(OC)c(OC)cc3oc2c1 |
IUPAC name | 1,3,6,7-tetramethoxy-9H-xanthen-9-one |
InChI | InChI=1S/C17H16O6/c1-19-9-5-14(22-4)16-15(6-9)23-11-8-13(21-3)12(20-2)7-10(11)17(16)18/h5-8H,1-4H3 |
InChIKey | SGQWQUYTTYVSBS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2Cc3ccccc13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Xanthones | Methyl xanthones |
Total atom number | 39 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 3.15 |
Alogp2 | 9.95 |
Apol | 45.4007 |
Bpol | 28.0293 |
EccentricConnectivityIndexDescriptor | 402 |
FmfDescriptor | 0.6087 |
Fsp3 | 0.2353 |
FragmentComplexityDescriptor | 1175.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1100 |
Xlogp | 3.604 |
ZagrebIndex | 122 |
TopoPSA | 67.13 |