Name | [(2s,3s)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-(prop-2-en-1-yl)-2,3-dihydro-1-benzofuran-3-yl]methanol |
Wikidata | Q105158146 |
Mol. formula | C21H24O5 |
CAS registry number | - |
Mol. weight | 356.4131 |
Temporary LOTUS id | LTS0152405 |
Name | [(2s,3s)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-(prop-2-en-1-yl)-2,3-dihydro-1-benzofuran-3-yl]methanol |
Canonical SMILES | C=CCc1cc(OC)c2c(c1)[C@@H](CO)[C@@H](c1ccc(OC)c(OC)c1)O2 |
2D SMILES | C=CCc1cc(OC)c2c(c1)C(CO)C(c1ccc(OC)c(OC)c1)O2 |
IUPAC name | [(2S,3S)-2-(3,4-dimethoxyphenyl)-7-methoxy-5-(prop-2-en-1-yl)-2,3-dihydro-1-benzofuran-3-yl]methanol |
InChI | InChI=1S/C21H24O5/c1-5-6-13-9-15-16(12-22)20(26-21(15)19(10-13)25-4)14-7-8-17(23-2)18(11-14)24-3/h5,7-11,16,20,22H,1,6,12H2,2-4H3/t16-,20-/m1/s1 |
InChIKey | LVZKPZQWUGCSQU-OXQOHEQNSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC1c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Neolignans |
Total atom number | 50 |
Heavy atom number | 26 |
Bond count | 28 |
Number of carbons | 21 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 3.56 |
Alogp2 | 12.66 |
Apol | 56.973 |
Bpol | 33.901 |
EccentricConnectivityIndexDescriptor | 528 |
FmfDescriptor | 0.5769 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 2054.05 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1616 |
Xlogp | 3.527 |
ZagrebIndex | 134 |
TopoPSA | 57.15 |