Name | (3s,4r,5r)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid |
Wikidata | Q105136687 |
Mol. formula | C7H10O5 |
CAS registry number | - |
Mol. weight | 174.1516 |
Temporary LOTUS id | LTS0152120 |
Name | (3s,4r,5r)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid |
Canonical SMILES | O=C(O)C1=C[C@H](O)[C@H](O)[C@H](O)C1 |
2D SMILES | O=C(O)C1=CC(O)C(O)C(O)C1 |
IUPAC name | (3S,4R,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid |
InChI | InChI=1S/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5+,6-/m0/s1 |
InChIKey | JXOHGGNKMLTUBP-JKUQZMGJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenolic acids (C6-C1) | Simple phenolic acids |
Total atom number | 22 |
Heavy atom number | 12 |
Bond count | 12 |
Number of carbons | 7 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.86 |
Alogp | -1.18 |
Alogp2 | 1.39 |
Apol | 22.9979 |
Bpol | 11.8901 |
EccentricConnectivityIndexDescriptor | 110 |
FmfDescriptor | 0.5 |
Fsp3 | 0.5714 |
FragmentComplexityDescriptor | 352.05 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 188 |
Xlogp | -1.094 |
ZagrebIndex | 58 |
TopoPSA | 97.99 |