Name | 1-(2,2-dimethylchromen-6-yl)ethanone |
Wikidata | Q67879834 |
Mol. formula | C13H14O2 |
CAS registry number | - |
Mol. weight | 202.2495 |
Temporary LOTUS id | LTS0151425 |
Name | 1-(2,2-dimethylchromen-6-yl)ethanone |
Canonical SMILES | CC(=O)c1ccc2c(c1)C=CC(C)(C)O2 |
2D SMILES | CC(=O)c1ccc2c(c1)C=CC(C)(C)O2 |
IUPAC name | 1-(2,2-dimethyl-2H-chromen-6-yl)ethan-1-one |
InChI | InChI=1S/C13H14O2/c1-9(14)10-4-5-12-11(8-10)6-7-13(2,3)15-12/h4-8H,1-3H3 |
InChIKey | ZAJTXVHECZCXLH-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2C=CC1 |
Pathway | Superclass | Class |
Terpenoids | Meroterpenoids | Merohemiterpenoids |
Total atom number | 29 |
Heavy atom number | 15 |
Bond count | 16 |
Number of carbons | 13 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 2.36 |
Alogp2 | 5.56 |
Apol | 33.8191 |
Bpol | 18.1789 |
EccentricConnectivityIndexDescriptor | 188 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.3077 |
FragmentComplexityDescriptor | 690.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 356 |
Xlogp | 2.74 |
ZagrebIndex | 80 |
TopoPSA | 26.3 |