Name | 4-{13-hydroxy-12,12-dimethyl-3,11-dioxatricyclo[8.4.0.0²,⁷]tetradeca-1,7,9-trien-4-yl}benzene-1,2-diol |
Wikidata | Q105207598 |
Mol. formula | C20H22O5 |
CAS registry number | - |
Mol. weight | 342.3864 |
Temporary LOTUS id | LTS0150800 |
Name | 4-{13-hydroxy-12,12-dimethyl-3,11-dioxatricyclo[8.4.0.0²,⁷]tetradeca-1,7,9-trien-4-yl}benzene-1,2-diol |
Canonical SMILES | CC1(C)Oc2ccc3c(c2CC1O)OC(c1ccc(O)c(O)c1)CC3 |
2D SMILES | CC1(C)Oc2ccc3c(c2CC1O)OC(c1ccc(O)c(O)c1)CC3 |
IUPAC name | 4-{13-hydroxy-12,12-dimethyl-3,11-dioxatricyclo[8.4.0.0²,⁷]tetradeca-1,7,9-trien-4-yl}benzene-1,2-diol |
InChI | InChI=1S/C20H22O5/c1-20(2)18(23)10-13-17(25-20)8-5-11-4-7-16(24-19(11)13)12-3-6-14(21)15(22)9-12/h3,5-6,8-9,16,18,21-23H,4,7,10H2,1-2H3 |
InChIKey | PFAGNKVPEVROSU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3c(OC(c4ccccc4)CC3)c2CCC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavans |
Total atom number | 47 |
Heavy atom number | 25 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.55 |
Alogp2 | 12.62 |
Apol | 53.8794 |
Bpol | 27.8826 |
EccentricConnectivityIndexDescriptor | 510 |
FmfDescriptor | 0.8 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 1900.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1452 |
Xlogp | 3.269 |
ZagrebIndex | 142 |
TopoPSA | 79.15 |