Name | 3-butyl-4-hydroxy-4,5-dihydro-3h-2-benzofuran-1-one |
Wikidata | Q104252493 |
Mol. formula | C12H16O3 |
CAS registry number | - |
Mol. weight | 208.2541 |
Temporary LOTUS id | LTS0148385 |
Name | 3-butyl-4-hydroxy-4,5-dihydro-3h-2-benzofuran-1-one |
Canonical SMILES | CCCCC1OC(=O)C2=C1C(O)CC=C2 |
2D SMILES | CCCCC1OC(=O)C2=C1C(O)CC=C2 |
IUPAC name | 3-butyl-4-hydroxy-1,3,4,5-tetrahydro-2-benzofuran-1-one |
InChI | InChI=1S/C12H16O3/c1-2-3-7-10-11-8(12(14)15-10)5-4-6-9(11)13/h4-5,9-10,13H,2-3,6-7H2,1H3 |
InChIKey | BPZGLXVGANTPTC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=2C=CCCC2C1 |
Pathway | Superclass | Class |
Polyketides | Cyclic polyketides | Phthalide derivatives |
Total atom number | 31 |
Heavy atom number | 15 |
Bond count | 16 |
Number of carbons | 12 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.97 |
Alogp | 2.09 |
Alogp2 | 4.36 |
Apol | 34.1947 |
Bpol | 20.3653 |
EccentricConnectivityIndexDescriptor | 193 |
FmfDescriptor | 0.6 |
Fsp3 | 0.5833 |
FragmentComplexityDescriptor | 814.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 353 |
Xlogp | 1.613 |
ZagrebIndex | 76 |
TopoPSA | 46.53 |